C30H26F6O3 — CID 145009741
5-[[2,6-difluoro-4-(4-methylphenyl)phenoxy]methyl]-2-(4,5,6,7-tetrafluoronaphthalen-2-yl)-1,3-dioxane;ethane (PubChem CID 145009741) has the molecular formula C30H26F6O3 and a molecular weight of 548.52 g/mol. Its IUPAC name is 5-[[2,6-difluoro-4-(4-methylphenyl)phenoxy]methyl]-2-(4,5,6,7-tetrafluoronaphthalen-2-yl)-1,3-dioxane;ethane.
| Compound Name | 5-[[2,6-difluoro-4-(4-methylphenyl)phenoxy]methyl]-2-(4,5,6,7-tetrafluoronaphthalen-2-yl)-1,3-dioxane;ethane |
|---|---|
| PubChem CID | 145009741 |
| Molecular Formula | C30H26F6O3 |
| Molecular Weight | 548.52 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 5-[[2,6-difluoro-4-(4-methylphenyl)phenoxy]methyl]-2-(4,5,6,7-tetrafluoronaphthalen-2-yl)-1,3-dioxane;ethane |
| SMILES | CC.Cc1ccc(-c2cc(F)c(OCC3COC(c4cc(F)c5c(F)c(F)c(F)cc5c4)OC3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H20F6O3.C2H6/c1-14-2-4-16(5-3-14)17-7-22(31)27(23(32)8-17)35-11-15-12-36-28(37-13-15)19-6-18-9-21(30)25(33)26(34)24(18)20(29)10-19;1-2/h2-10,15,28H,11-13H2,1H3;1-2H3 |
| InChIKey | OXCRZAUVGLIXSM-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.52 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|