C21H20F4O4 — CID 122500656
2-[4-[4-(2,2-difluoroethenoxy)-3,5-difluorophenyl]phenyl]-5-(ethoxymethyl)-1,3-dioxane (PubChem CID 122500656) has the molecular formula C21H20F4O4 and a molecular weight of 412.38 g/mol. Its IUPAC name is 2-[4-[4-(2,2-difluoroethenoxy)-3,5-difluorophenyl]phenyl]-5-(ethoxymethyl)-1,3-dioxane.
| Compound Name | 2-[4-[4-(2,2-difluoroethenoxy)-3,5-difluorophenyl]phenyl]-5-(ethoxymethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 122500656 |
| Molecular Formula | C21H20F4O4 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 2-[4-[4-(2,2-difluoroethenoxy)-3,5-difluorophenyl]phenyl]-5-(ethoxymethyl)-1,3-dioxane |
| SMILES | CCOCC1COC(c2ccc(-c3cc(F)c(OC=C(F)F)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C21H20F4O4/c1-2-26-9-13-10-28-21(29-11-13)15-5-3-14(4-6-15)16-7-17(22)20(18(23)8-16)27-12-19(24)25/h3-8,12-13,21H,2,9-11H2,1H3 |
| InChIKey | UIBDOFKKCXTWSS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|