C28H20F8O4 — CID 123219174
2-[4-[4-[[4-(2,2-difluoroethenoxy)-3,5-difluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-prop-1-enyl-1,3-dioxane (PubChem CID 123219174) has the molecular formula C28H20F8O4 and a molecular weight of 572.45 g/mol. Its IUPAC name is 2-[4-[4-[[4-(2,2-difluoroethenoxy)-3,5-difluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-prop-1-enyl-1,3-dioxane.
| Compound Name | 2-[4-[4-[[4-(2,2-difluoroethenoxy)-3,5-difluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-prop-1-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 123219174 |
| Molecular Formula | C28H20F8O4 |
| Molecular Weight | 572.45 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | 2-[4-[4-[[4-(2,2-difluoroethenoxy)-3,5-difluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-prop-1-enyl-1,3-dioxane |
| SMILES | CC=CC1COC(c2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(OC=C(F)F)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C28H20F8O4/c1-2-3-15-12-38-27(39-13-15)17-6-4-16(5-7-17)18-8-20(29)25(21(30)9-18)28(35,36)40-19-10-22(31)26(23(32)11-19)37-14-24(33)34/h2-11,14-15,27H,12-13H2,1H3 |
| InChIKey | KJVHVYKIHWCXAN-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.45 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|