C26H21F5O3 — CID 122577221
2-[4-[[4-(3,4-difluorophenyl)-3-fluorophenoxy]-difluoromethyl]phenyl]-5-[(E)-prop-1-enyl]-1,3-dioxane (PubChem CID 122577221) has the molecular formula C26H21F5O3 and a molecular weight of 476.44 g/mol. Its IUPAC name is 2-[4-[[4-(3,4-difluorophenyl)-3-fluorophenoxy]-difluoromethyl]phenyl]-5-[(E)-prop-1-enyl]-1,3-dioxane.
| Compound Name | 2-[4-[[4-(3,4-difluorophenyl)-3-fluorophenoxy]-difluoromethyl]phenyl]-5-[(E)-prop-1-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 122577221 |
| Molecular Formula | C26H21F5O3 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-[4-[[4-(3,4-difluorophenyl)-3-fluorophenoxy]-difluoromethyl]phenyl]-5-[(E)-prop-1-enyl]-1,3-dioxane |
| SMILES | C/C=C/C1COC(c2ccc(C(F)(F)Oc3ccc(-c4ccc(F)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C26H21F5O3/c1-2-3-16-14-32-25(33-15-16)17-4-7-19(8-5-17)26(30,31)34-20-9-10-21(23(28)13-20)18-6-11-22(27)24(29)12-18/h2-13,16,25H,14-15H2,1H3/b3-2+ |
| InChIKey | LVWSDWQFAMQUQL-NSCUHMNNSA-N |
| XLogP | 7.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|