C33H30F8O4 — CID 122577097
2-[4-[[3,5-difluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenoxy]-difluoromethyl]phenyl]-5-[(3E,7E)-nona-3,7-dienyl]-1,3-dioxane (PubChem CID 122577097) has the molecular formula C33H30F8O4 and a molecular weight of 642.58 g/mol. Its IUPAC name is 2-[4-[[3,5-difluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenoxy]-difluoromethyl]phenyl]-5-[(3E,7E)-nona-3,7-dienyl]-1,3-dioxane.
| Compound Name | 2-[4-[[3,5-difluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenoxy]-difluoromethyl]phenyl]-5-[(3E,7E)-nona-3,7-dienyl]-1,3-dioxane |
|---|---|
| PubChem CID | 122577097 |
| Molecular Formula | C33H30F8O4 |
| Molecular Weight | 642.58 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | 2-[4-[[3,5-difluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenoxy]-difluoromethyl]phenyl]-5-[(3E,7E)-nona-3,7-dienyl]-1,3-dioxane |
| SMILES | C/C=C/CC/C=C/CCC1COC(c2ccc(C(F)(F)Oc3cc(F)c(-c4ccc(OC(F)(F)F)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C33H30F8O4/c1-2-3-4-5-6-7-8-9-21-19-42-31(43-20-21)22-10-13-24(14-11-22)32(37,38)44-25-17-27(35)30(28(36)18-25)23-12-15-29(26(34)16-23)45-33(39,40)41/h2-3,6-7,10-18,21,31H,4-5,8-9,19-20H2,1H3/b3-2+,7-6+ |
| InChIKey | BIOWERYOCGDVIK-BLWKUPHCSA-N |
| XLogP | 10.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.58 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|