C17H12F6O3S — CID 129171096
2-[3,5-difluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-1,3-dioxane-5-thiol (PubChem CID 129171096) has the molecular formula C17H12F6O3S and a molecular weight of 410.34 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-1,3-dioxane-5-thiol.
| Compound Name | 2-[3,5-difluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-1,3-dioxane-5-thiol |
|---|---|
| PubChem CID | 129171096 |
| Molecular Formula | C17H12F6O3S |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 2-[3,5-difluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-1,3-dioxane-5-thiol |
| SMILES | Fc1cc(-c2c(F)cc(C3OCC(S)CO3)cc2F)ccc1OC(F)(F)F |
| InChI | InChI=1S/C17H12F6O3S/c18-11-3-8(1-2-14(11)26-17(21,22)23)15-12(19)4-9(5-13(15)20)16-24-6-10(27)7-25-16/h1-5,10,16,27H,6-7H2 |
| InChIKey | PIIINBZOJDMXEH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|