C24H24F6O3 — CID 143091550
2-[3,5-difluoro-4-[fluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-5-(4-methylcyclohexyl)-1,3-dioxane (PubChem CID 143091550) has the molecular formula C24H24F6O3 and a molecular weight of 474.44 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-[fluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-5-(4-methylcyclohexyl)-1,3-dioxane.
| Compound Name | 2-[3,5-difluoro-4-[fluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-5-(4-methylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 143091550 |
| Molecular Formula | C24H24F6O3 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2-[3,5-difluoro-4-[fluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-5-(4-methylcyclohexyl)-1,3-dioxane |
| SMILES | CC1CCC(C2COC(c3cc(F)c(C(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)OC2)CC1 |
| InChI | InChI=1S/C24H24F6O3/c1-12-2-4-13(5-3-12)15-10-31-24(32-11-15)14-6-17(25)21(18(26)7-14)23(30)33-16-8-19(27)22(29)20(28)9-16/h6-9,12-13,15,23-24H,2-5,10-11H2,1H3 |
| InChIKey | OOTLDTKBJWDQIK-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|