C19H24F4 — CID 163858188
1,2,3-trifluoro-5-[2-fluoro-4-(4-methylcyclohexyl)cyclohexyl]benzene (PubChem CID 163858188) has the molecular formula C19H24F4 and a molecular weight of 328.39 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[2-fluoro-4-(4-methylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[2-fluoro-4-(4-methylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 163858188 |
| Molecular Formula | C19H24F4 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1,2,3-trifluoro-5-[2-fluoro-4-(4-methylcyclohexyl)cyclohexyl]benzene |
| SMILES | CC1CCC(C2CCC(c3cc(F)c(F)c(F)c3)C(F)C2)CC1 |
| InChI | InChI=1S/C19H24F4/c1-11-2-4-12(5-3-11)13-6-7-15(16(20)8-13)14-9-17(21)19(23)18(22)10-14/h9-13,15-16H,2-8H2,1H3 |
| InChIKey | PAERQYAYDYCDOI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|