C20H29F — CID 137384106
1-[(4S)-2-fluoro-4-(4-methylcyclohexyl)cyclohexyl]-4-methylbenzene (PubChem CID 137384106) has the molecular formula C20H29F and a molecular weight of 288.45 g/mol. Its IUPAC name is 1-[(4S)-2-fluoro-4-(4-methylcyclohexyl)cyclohexyl]-4-methylbenzene.
| Compound Name | 1-[(4S)-2-fluoro-4-(4-methylcyclohexyl)cyclohexyl]-4-methylbenzene |
|---|---|
| PubChem CID | 137384106 |
| Molecular Formula | C20H29F |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 1-[(4S)-2-fluoro-4-(4-methylcyclohexyl)cyclohexyl]-4-methylbenzene |
| SMILES | Cc1ccc(C2CC[C@H](C3CCC(C)CC3)CC2F)cc1 |
| InChI | InChI=1S/C20H29F/c1-14-3-7-16(8-4-14)18-11-12-19(20(21)13-18)17-9-5-15(2)6-10-17/h5-6,9-10,14,16,18-20H,3-4,7-8,11-13H2,1-2H3/t14?,16?,18-,19?,20?/m0/s1 |
| InChIKey | SYQQJOYLIJSXEG-IYSLTGRPSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |