C27H26F7O2P — CID 144529300
[2-[3,5-difluoro-4-[fluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-3-fluoro-5-(5-methyloxan-2-yl)phenyl]phosphane;ethane (PubChem CID 144529300) has the molecular formula C27H26F7O2P and a molecular weight of 546.46 g/mol. Its IUPAC name is [2-[3,5-difluoro-4-[fluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-3-fluoro-5-(5-methyloxan-2-yl)phenyl]phosphane;ethane.
| Compound Name | [2-[3,5-difluoro-4-[fluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-3-fluoro-5-(5-methyloxan-2-yl)phenyl]phosphane;ethane |
|---|---|
| PubChem CID | 144529300 |
| Molecular Formula | C27H26F7O2P |
| Molecular Weight | 546.46 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | [2-[3,5-difluoro-4-[fluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-3-fluoro-5-(5-methyloxan-2-yl)phenyl]phosphane;ethane |
| SMILES | CC.CC1CCC(c2cc(F)c(-c3cc(F)c(C(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(P)c2)OC1 |
| InChI | InChI=1S/C25H20F7O2P.C2H6/c1-11-2-3-20(33-10-11)12-4-15(26)22(21(35)7-12)13-5-16(27)23(17(28)6-13)25(32)34-14-8-18(29)24(31)19(30)9-14;1-2/h4-9,11,20,25H,2-3,10,35H2,1H3;1-2H3 |
| InChIKey | LKPLVAYYCCFPQQ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.46 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|