C32H27F5O3 — CID 59787690
(4,5,7-trifluoro-6-methylnaphthalen-2-yl) 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoate (PubChem CID 59787690) has the molecular formula C32H27F5O3 and a molecular weight of 554.56 g/mol. Its IUPAC name is (4,5,7-trifluoro-6-methylnaphthalen-2-yl) 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoate.
| Compound Name | (4,5,7-trifluoro-6-methylnaphthalen-2-yl) 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 59787690 |
| Molecular Formula | C32H27F5O3 |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | (4,5,7-trifluoro-6-methylnaphthalen-2-yl) 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoate |
| SMILES | Cc1cc(C2CCC(C)CO2)cc(C)c1-c1cc(F)c(C(=O)Oc2cc(F)c3c(F)c(C)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C32H27F5O3/c1-15-5-6-27(39-14-15)19-7-16(2)28(17(3)8-19)21-11-24(34)30(25(35)12-21)32(38)40-22-9-20-10-23(33)18(4)31(37)29(20)26(36)13-22/h7-13,15,27H,5-6,14H2,1-4H3 |
| InChIKey | KFYVKRMXYIKVMX-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|