C25H31F3O — CID 159770730
5-methyl-2-[4-[[4-(3,4,5-trifluorophenyl)phenyl]methyl]cyclohexyl]oxane;molecular hydrogen (PubChem CID 159770730) has the molecular formula C25H31F3O and a molecular weight of 404.52 g/mol. Its IUPAC name is 5-methyl-2-[4-[[4-(3,4,5-trifluorophenyl)phenyl]methyl]cyclohexyl]oxane;molecular hydrogen.
| Compound Name | 5-methyl-2-[4-[[4-(3,4,5-trifluorophenyl)phenyl]methyl]cyclohexyl]oxane;molecular hydrogen |
|---|---|
| PubChem CID | 159770730 |
| Molecular Formula | C25H31F3O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 5-methyl-2-[4-[[4-(3,4,5-trifluorophenyl)phenyl]methyl]cyclohexyl]oxane;molecular hydrogen |
| SMILES | CC1CCC(C2CCC(Cc3ccc(-c4cc(F)c(F)c(F)c4)cc3)CC2)OC1.[H][H] |
| InChI | InChI=1S/C25H29F3O.H2/c1-16-2-11-24(29-15-16)20-9-5-18(6-10-20)12-17-3-7-19(8-4-17)21-13-22(26)25(28)23(27)14-21;/h3-4,7-8,13-14,16,18,20,24H,2,5-6,9-12,15H2,1H3;1H |
| InChIKey | NGBQKRWJTZCHHP-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|