C32H48FNO — CID 135214922
N-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]cyclohexyl]prop-2-enamide (PubChem CID 135214922) has the molecular formula C32H48FNO and a molecular weight of 481.74 g/mol. Its IUPAC name is N-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]cyclohexyl]prop-2-enamide.
| Compound Name | N-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 135214922 |
| Molecular Formula | C32H48FNO |
| Molecular Weight | 481.74 g/mol |
| Exact Mass | 481.37 |
| IUPAC Name | N-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCC(c2ccc(C3CCC(C4CCC(CCCCC)CC4)CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C32H48FNO/c1-3-5-6-7-23-8-10-24(11-9-23)25-12-14-27(15-13-25)30-21-18-28(22-31(30)33)26-16-19-29(20-17-26)34-32(35)4-2/h4,18,21-27,29H,2-3,5-17,19-20H2,1H3,(H,34,35) |
| InChIKey | YMZPNGSVMLGPAE-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.74 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|