C32H46FNO — CID 134245771
N-[4-[4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-2-fluorophenyl]cyclohexyl]-2-methylprop-2-enamide (PubChem CID 134245771) has the molecular formula C32H46FNO and a molecular weight of 479.72 g/mol. Its IUPAC name is N-[4-[4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-2-fluorophenyl]cyclohexyl]-2-methylprop-2-enamide.
| Compound Name | N-[4-[4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-2-fluorophenyl]cyclohexyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 134245771 |
| Molecular Formula | C32H46FNO |
| Molecular Weight | 479.72 g/mol |
| Exact Mass | 479.36 |
| IUPAC Name | N-[4-[4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-2-fluorophenyl]cyclohexyl]-2-methylprop-2-enamide |
| SMILES | C=CCCC1CCC(C2CCC(c3ccc(C4CCC(NC(=O)C(=C)C)CC4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C32H46FNO/c1-4-5-6-23-7-9-24(10-8-23)25-11-13-26(14-12-25)28-17-20-30(31(33)21-28)27-15-18-29(19-16-27)34-32(35)22(2)3/h4,17,20-21,23-27,29H,1-2,5-16,18-19H2,3H3,(H,34,35) |
| InChIKey | RIXGVQAKDFJKIF-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.72 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|