C28H49NO — CID 134244880
N-[4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]cyclohexyl]prop-2-enamide (PubChem CID 134244880) has the molecular formula C28H49NO and a molecular weight of 415.71 g/mol. Its IUPAC name is N-[4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]cyclohexyl]prop-2-enamide.
| Compound Name | N-[4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 134244880 |
| Molecular Formula | C28H49NO |
| Molecular Weight | 415.71 g/mol |
| Exact Mass | 415.38 |
| IUPAC Name | N-[4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCC(CCC2CCC(C3CCC(CCCCC)CC3)CC2)CC1 |
| InChI | InChI=1S/C28H49NO/c1-3-5-6-7-22-10-16-25(17-11-22)26-18-12-23(13-19-26)8-9-24-14-20-27(21-15-24)29-28(30)4-2/h4,22-27H,2-3,5-21H2,1H3,(H,29,30) |
| InChIKey | DAXZERHLPURCSW-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.71 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|