C20H34FNO — CID 134244993
N-[4-[4-(5-fluoropentyl)cyclohexyl]cyclohexyl]prop-2-enamide (PubChem CID 134244993) has the molecular formula C20H34FNO and a molecular weight of 323.50 g/mol. Its IUPAC name is N-[4-[4-(5-fluoropentyl)cyclohexyl]cyclohexyl]prop-2-enamide.
| Compound Name | N-[4-[4-(5-fluoropentyl)cyclohexyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 134244993 |
| Molecular Formula | C20H34FNO |
| Molecular Weight | 323.50 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | N-[4-[4-(5-fluoropentyl)cyclohexyl]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCC(C2CCC(CCCCCF)CC2)CC1 |
| InChI | InChI=1S/C20H34FNO/c1-2-20(23)22-19-13-11-18(12-14-19)17-9-7-16(8-10-17)6-4-3-5-15-21/h2,16-19H,1,3-15H2,(H,22,23) |
| InChIKey | NAPHPNNMFHTSKW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|