C32H53NO — CID 134245605
N-[4-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]cyclohexyl]cyclohexyl]prop-2-enamide (PubChem CID 134245605) has the molecular formula C32H53NO and a molecular weight of 467.78 g/mol. Its IUPAC name is N-[4-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]cyclohexyl]cyclohexyl]prop-2-enamide.
| Compound Name | N-[4-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]cyclohexyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 134245605 |
| Molecular Formula | C32H53NO |
| Molecular Weight | 467.78 g/mol |
| Exact Mass | 467.41 |
| IUPAC Name | N-[4-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]cyclohexyl]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCC(C2CCC(C3=CCC(C4CCC(CCCCC)CC4)CC3)CC2)CC1 |
| InChI | InChI=1S/C32H53NO/c1-3-5-6-7-24-8-10-25(11-9-24)26-12-14-27(15-13-26)28-16-18-29(19-17-28)30-20-22-31(23-21-30)33-32(34)4-2/h4,14,24-26,28-31H,2-3,5-13,15-23H2,1H3,(H,33,34) |
| InChIKey | YYOKUUZMDDVTJX-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.78 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|