C32H49NO4 — CID 135214980
N-[2-[4-[4-[5-(4-pentylcyclohexyl)-1,3-dioxan-2-yl]phenyl]cyclohexyl]oxyethyl]prop-2-enamide (PubChem CID 135214980) has the molecular formula C32H49NO4 and a molecular weight of 511.75 g/mol. Its IUPAC name is N-[2-[4-[4-[5-(4-pentylcyclohexyl)-1,3-dioxan-2-yl]phenyl]cyclohexyl]oxyethyl]prop-2-enamide.
| Compound Name | N-[2-[4-[4-[5-(4-pentylcyclohexyl)-1,3-dioxan-2-yl]phenyl]cyclohexyl]oxyethyl]prop-2-enamide |
|---|---|
| PubChem CID | 135214980 |
| Molecular Formula | C32H49NO4 |
| Molecular Weight | 511.75 g/mol |
| Exact Mass | 511.37 |
| IUPAC Name | N-[2-[4-[4-[5-(4-pentylcyclohexyl)-1,3-dioxan-2-yl]phenyl]cyclohexyl]oxyethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCOC1CCC(c2ccc(C3OCC(C4CCC(CCCCC)CC4)CO3)cc2)CC1 |
| InChI | InChI=1S/C32H49NO4/c1-3-5-6-7-24-8-10-27(11-9-24)29-22-36-32(37-23-29)28-14-12-25(13-15-28)26-16-18-30(19-17-26)35-21-20-33-31(34)4-2/h4,12-15,24,26-27,29-30,32H,2-3,5-11,16-23H2,1H3,(H,33,34) |
| InChIKey | BFDRUPAMRIMCEQ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.75 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|