C26H34O2 — CID 134190948
7-[4-[(1E)-hexa-1,5-dienyl]cyclohexyl]-3-pentylisochromen-1-one (PubChem CID 134190948) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 7-[4-[(1E)-hexa-1,5-dienyl]cyclohexyl]-3-pentylisochromen-1-one.
| Compound Name | 7-[4-[(1E)-hexa-1,5-dienyl]cyclohexyl]-3-pentylisochromen-1-one |
|---|---|
| PubChem CID | 134190948 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 7-[4-[(1E)-hexa-1,5-dienyl]cyclohexyl]-3-pentylisochromen-1-one |
| SMILES | C=CCC/C=C/C1CCC(c2ccc3cc(CCCCC)oc(=O)c3c2)CC1 |
| InChI | InChI=1S/C26H34O2/c1-3-5-7-9-10-20-12-14-21(15-13-20)22-16-17-23-18-24(11-8-6-4-2)28-26(27)25(23)19-22/h3,9-10,16-21H,1,4-8,11-15H2,2H3/b10-9+ |
| InChIKey | IXHQPZIHXDMHJJ-MDZDMXLPSA-N |
| XLogP | 7.32 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|