C29H41FO2 — CID 134190855
8-fluoro-3-nonyl-7-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]isochromen-1-one (PubChem CID 134190855) has the molecular formula C29H41FO2 and a molecular weight of 440.64 g/mol. Its IUPAC name is 8-fluoro-3-nonyl-7-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]isochromen-1-one.
| Compound Name | 8-fluoro-3-nonyl-7-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]isochromen-1-one |
|---|---|
| PubChem CID | 134190855 |
| Molecular Formula | C29H41FO2 |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | 8-fluoro-3-nonyl-7-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]isochromen-1-one |
| SMILES | C/C=C/C1CCC(CCc2ccc3cc(CCCCCCCCC)oc(=O)c3c2F)CC1 |
| InChI | InChI=1S/C29H41FO2/c1-3-5-6-7-8-9-10-12-26-21-25-20-19-24(28(30)27(25)29(31)32-26)18-17-23-15-13-22(11-4-2)14-16-23/h4,11,19-23H,3,5-10,12-18H2,1-2H3/b11-4+ |
| InChIKey | SPKYYUPVBSTLLL-NYYWCZLTSA-N |
| XLogP | 8.54 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|