C24H25F3O2 — CID 134190875
7-[2-(2,3-difluoro-4-pentylphenyl)ethyl]-3-ethyl-8-fluoroisochromen-1-one (PubChem CID 134190875) has the molecular formula C24H25F3O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 7-[2-(2,3-difluoro-4-pentylphenyl)ethyl]-3-ethyl-8-fluoroisochromen-1-one.
| Compound Name | 7-[2-(2,3-difluoro-4-pentylphenyl)ethyl]-3-ethyl-8-fluoroisochromen-1-one |
|---|---|
| PubChem CID | 134190875 |
| Molecular Formula | C24H25F3O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 7-[2-(2,3-difluoro-4-pentylphenyl)ethyl]-3-ethyl-8-fluoroisochromen-1-one |
| SMILES | CCCCCc1ccc(CCc2ccc3cc(CC)oc(=O)c3c2F)c(F)c1F |
| InChI | InChI=1S/C24H25F3O2/c1-3-5-6-7-15-8-10-17(23(27)22(15)26)11-9-16-12-13-18-14-19(4-2)29-24(28)20(18)21(16)25/h8,10,12-14H,3-7,9,11H2,1-2H3 |
| InChIKey | MCGRBWRSKQPCEU-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|