C23H31FO3 — CID 134191026
7-[(4-ethylcyclohexyl)oxymethyl]-8-fluoro-3-pentylisochromen-1-one (PubChem CID 134191026) has the molecular formula C23H31FO3 and a molecular weight of 374.50 g/mol. Its IUPAC name is 7-[(4-ethylcyclohexyl)oxymethyl]-8-fluoro-3-pentylisochromen-1-one.
| Compound Name | 7-[(4-ethylcyclohexyl)oxymethyl]-8-fluoro-3-pentylisochromen-1-one |
|---|---|
| PubChem CID | 134191026 |
| Molecular Formula | C23H31FO3 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 7-[(4-ethylcyclohexyl)oxymethyl]-8-fluoro-3-pentylisochromen-1-one |
| SMILES | CCCCCc1cc2ccc(COC3CCC(CC)CC3)c(F)c2c(=O)o1 |
| InChI | InChI=1S/C23H31FO3/c1-3-5-6-7-20-14-17-10-11-18(22(24)21(17)23(25)27-20)15-26-19-12-8-16(4-2)9-13-19/h10-11,14,16,19H,3-9,12-13,15H2,1-2H3 |
| InChIKey | ZBVFZNJDCXRAOG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|