C20H24O4 — CID 25256858
3,6-bis(4-propylphenyl)-1,2,4,5-tetraoxane (PubChem CID 25256858) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 3,6-bis(4-propylphenyl)-1,2,4,5-tetraoxane.
| Compound Name | 3,6-bis(4-propylphenyl)-1,2,4,5-tetraoxane |
|---|---|
| PubChem CID | 25256858 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 3,6-bis(4-propylphenyl)-1,2,4,5-tetraoxane |
| SMILES | CCCc1ccc(C2OOC(c3ccc(CCC)cc3)OO2)cc1 |
| InChI | InChI=1S/C20H24O4/c1-3-5-15-7-11-17(12-8-15)19-21-23-20(24-22-19)18-13-9-16(6-4-2)10-14-18/h7-14,19-20H,3-6H2,1-2H3 |
| InChIKey | XISRMKWNKMEBJJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|