C20H26F2O2 — CID 67741105
5-[(E)-but-2-enyl]-2-[4-(3,4-difluorophenyl)cyclohexyl]-1,3-dioxane (PubChem CID 67741105) has the molecular formula C20H26F2O2 and a molecular weight of 336.42 g/mol. Its IUPAC name is 5-[(E)-but-2-enyl]-2-[4-(3,4-difluorophenyl)cyclohexyl]-1,3-dioxane.
| Compound Name | 5-[(E)-but-2-enyl]-2-[4-(3,4-difluorophenyl)cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 67741105 |
| Molecular Formula | C20H26F2O2 |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 5-[(E)-but-2-enyl]-2-[4-(3,4-difluorophenyl)cyclohexyl]-1,3-dioxane |
| SMILES | C/C=C/CC1COC(C2CCC(c3ccc(F)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C20H26F2O2/c1-2-3-4-14-12-23-20(24-13-14)16-7-5-15(6-8-16)17-9-10-18(21)19(22)11-17/h2-3,9-11,14-16,20H,4-8,12-13H2,1H3/b3-2+ |
| InChIKey | FFGUJIIOWYZWSK-NSCUHMNNSA-N |
| XLogP | 5.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|