C26H30F2O2 — CID 18997892
5-but-3-enyl-2-[4-[4-(3,4-difluorophenyl)phenyl]cyclohexyl]-1,3-dioxane (PubChem CID 18997892) has the molecular formula C26H30F2O2 and a molecular weight of 412.52 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-[4-(3,4-difluorophenyl)phenyl]cyclohexyl]-1,3-dioxane.
| Compound Name | 5-but-3-enyl-2-[4-[4-(3,4-difluorophenyl)phenyl]cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 18997892 |
| Molecular Formula | C26H30F2O2 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 5-but-3-enyl-2-[4-[4-(3,4-difluorophenyl)phenyl]cyclohexyl]-1,3-dioxane |
| SMILES | C=CCCC1COC(C2CCC(c3ccc(-c4ccc(F)c(F)c4)cc3)CC2)OC1 |
| InChI | InChI=1S/C26H30F2O2/c1-2-3-4-18-16-29-26(30-17-18)22-11-9-20(10-12-22)19-5-7-21(8-6-19)23-13-14-24(27)25(28)15-23/h2,5-8,13-15,18,20,22,26H,1,3-4,9-12,16-17H2 |
| InChIKey | CPWRJZOAFOCAQX-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|