C21H29ClO2 — CID 18652901
2-[4-(4-chlorophenyl)cyclohexyl]-5-pent-4-enyl-1,3-dioxane (PubChem CID 18652901) has the molecular formula C21H29ClO2 and a molecular weight of 348.91 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)cyclohexyl]-5-pent-4-enyl-1,3-dioxane.
| Compound Name | 2-[4-(4-chlorophenyl)cyclohexyl]-5-pent-4-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 18652901 |
| Molecular Formula | C21H29ClO2 |
| Molecular Weight | 348.91 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-[4-(4-chlorophenyl)cyclohexyl]-5-pent-4-enyl-1,3-dioxane |
| SMILES | C=CCCCC1COC(C2CCC(c3ccc(Cl)cc3)CC2)OC1 |
| InChI | InChI=1S/C21H29ClO2/c1-2-3-4-5-16-14-23-21(24-15-16)19-8-6-17(7-9-19)18-10-12-20(22)13-11-18/h2,10-13,16-17,19,21H,1,3-9,14-15H2 |
| InChIKey | JERBJJKIEHUOAL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.91 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|