C25H39ClO2 — CID 67742702
(2S,4R,5S)-2-[4-(4-chlorophenyl)cyclohexyl]-4-methyl-5-octyl-1,3-dioxane (PubChem CID 67742702) has the molecular formula C25H39ClO2 and a molecular weight of 407.04 g/mol. Its IUPAC name is (2S,4R,5S)-2-[4-(4-chlorophenyl)cyclohexyl]-4-methyl-5-octyl-1,3-dioxane.
| Compound Name | (2S,4R,5S)-2-[4-(4-chlorophenyl)cyclohexyl]-4-methyl-5-octyl-1,3-dioxane |
|---|---|
| PubChem CID | 67742702 |
| Molecular Formula | C25H39ClO2 |
| Molecular Weight | 407.04 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | (2S,4R,5S)-2-[4-(4-chlorophenyl)cyclohexyl]-4-methyl-5-octyl-1,3-dioxane |
| SMILES | CCCCCCCC[C@H]1CO[C@H](C2CCC(c3ccc(Cl)cc3)CC2)O[C@@H]1C |
| InChI | InChI=1S/C25H39ClO2/c1-3-4-5-6-7-8-9-23-18-27-25(28-19(23)2)22-12-10-20(11-13-22)21-14-16-24(26)17-15-21/h14-17,19-20,22-23,25H,3-13,18H2,1-2H3/t19-,20?,22?,23+,25+/m1/s1 |
| InChIKey | FSULNZXDGSRBTP-VYHWBNPESA-N |
| XLogP | 7.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.04 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|