C22H28O2 — CID 19781307
5-but-3-enyl-2-[4-(4-ethynylphenyl)cyclohexyl]-1,3-dioxane (PubChem CID 19781307) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-(4-ethynylphenyl)cyclohexyl]-1,3-dioxane.
| Compound Name | 5-but-3-enyl-2-[4-(4-ethynylphenyl)cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 19781307 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 5-but-3-enyl-2-[4-(4-ethynylphenyl)cyclohexyl]-1,3-dioxane |
| SMILES | C#Cc1ccc(C2CCC(C3OCC(CCC=C)CO3)CC2)cc1 |
| InChI | InChI=1S/C22H28O2/c1-3-5-6-18-15-23-22(24-16-18)21-13-11-20(12-14-21)19-9-7-17(4-2)8-10-19/h2-3,7-10,18,20-22H,1,5-6,11-16H2 |
| InChIKey | YGKYLPURRNMQRD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|