C29H27F9O3 — CID 122577072
5-but-3-enyl-2-[4-[(E)-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,2-difluoroethenyl]cyclohexyl]-1,3-dioxane (PubChem CID 122577072) has the molecular formula C29H27F9O3 and a molecular weight of 594.51 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-[(E)-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,2-difluoroethenyl]cyclohexyl]-1,3-dioxane.
| Compound Name | 5-but-3-enyl-2-[4-[(E)-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,2-difluoroethenyl]cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 122577072 |
| Molecular Formula | C29H27F9O3 |
| Molecular Weight | 594.51 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | 5-but-3-enyl-2-[4-[(E)-2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,2-difluoroethenyl]cyclohexyl]-1,3-dioxane |
| SMILES | C=CCCC1COC(C2CCC(/C(F)=C(\F)c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C29H27F9O3/c1-2-3-4-15-13-39-28(40-14-15)17-7-5-16(6-8-17)25(34)26(35)18-9-20(30)24(21(31)10-18)29(37,38)41-19-11-22(32)27(36)23(33)12-19/h2,9-12,15-17,28H,1,3-8,13-14H2/b26-25+ |
| InChIKey | KKYHPAAYXXWCJQ-OCEACIFDSA-N |
| XLogP | 8.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.51 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|