C29H27F11O3 — CID 122577054
5-but-3-enyl-2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,1,2,2-tetrafluoroethyl]cyclohexyl]-1,3-dioxane (PubChem CID 122577054) has the molecular formula C29H27F11O3 and a molecular weight of 632.51 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,1,2,2-tetrafluoroethyl]cyclohexyl]-1,3-dioxane.
| Compound Name | 5-but-3-enyl-2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,1,2,2-tetrafluoroethyl]cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 122577054 |
| Molecular Formula | C29H27F11O3 |
| Molecular Weight | 632.51 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | 5-but-3-enyl-2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,1,2,2-tetrafluoroethyl]cyclohexyl]-1,3-dioxane |
| SMILES | C=CCCC1COC(C2CCC(C(F)(F)C(F)(F)c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C29H27F11O3/c1-2-3-4-15-13-41-26(42-14-15)16-5-7-17(8-6-16)27(35,36)28(37,38)18-9-20(30)24(21(31)10-18)29(39,40)43-19-11-22(32)25(34)23(33)12-19/h2,9-12,15-17,26H,1,3-8,13-14H2 |
| InChIKey | HAGHQMNUNQXOIS-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.51 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|