C28H28F6O5 — CID 122577177
[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl] 4-(5-but-3-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate (PubChem CID 122577177) has the molecular formula C28H28F6O5 and a molecular weight of 558.52 g/mol. Its IUPAC name is [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl] 4-(5-but-3-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate.
| Compound Name | [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl] 4-(5-but-3-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 122577177 |
| Molecular Formula | C28H28F6O5 |
| Molecular Weight | 558.52 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl] 4-(5-but-3-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate |
| SMILES | C=CCCC1COC(C2CCC(C(=O)Oc3ccc(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C28H28F6O5/c1-2-3-4-16-14-36-27(37-15-16)18-7-5-17(6-8-18)26(35)38-19-9-10-21(22(29)11-19)28(33,34)39-20-12-23(30)25(32)24(31)13-20/h2,9-13,16-18,27H,1,3-8,14-15H2 |
| InChIKey | HLOKTCCIBMBZHE-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.52 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|