C32H43F5O4 — CID 123612296
2-[4-[2-[4-[[4-(2,2-difluoroethenoxy)-3-fluorophenoxy]-difluoromethyl]cyclohexyl]ethenyl]cyclohexyl]-5-pentyl-1,3-dioxane (PubChem CID 123612296) has the molecular formula C32H43F5O4 and a molecular weight of 586.68 g/mol. Its IUPAC name is 2-[4-[2-[4-[[4-(2,2-difluoroethenoxy)-3-fluorophenoxy]-difluoromethyl]cyclohexyl]ethenyl]cyclohexyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[4-[2-[4-[[4-(2,2-difluoroethenoxy)-3-fluorophenoxy]-difluoromethyl]cyclohexyl]ethenyl]cyclohexyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 123612296 |
| Molecular Formula | C32H43F5O4 |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | 2-[4-[2-[4-[[4-(2,2-difluoroethenoxy)-3-fluorophenoxy]-difluoromethyl]cyclohexyl]ethenyl]cyclohexyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(C2CCC(C=CC3CCC(C(F)(F)Oc4ccc(OC=C(F)F)c(F)c4)CC3)CC2)OC1 |
| InChI | InChI=1S/C32H43F5O4/c1-2-3-4-5-24-19-39-31(40-20-24)25-12-8-22(9-13-25)6-7-23-10-14-26(15-11-23)32(36,37)41-27-16-17-29(28(33)18-27)38-21-30(34)35/h6-7,16-18,21-26,31H,2-5,8-15,19-20H2,1H3 |
| InChIKey | HSACIOAUZTYBBG-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|