C23H27F3O — CID 139860541
6-[difluoro-[4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-3-fluoro-2-propylnaphthalene (PubChem CID 139860541) has the molecular formula C23H27F3O and a molecular weight of 376.46 g/mol. Its IUPAC name is 6-[difluoro-[4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-3-fluoro-2-propylnaphthalene.
| Compound Name | 6-[difluoro-[4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-3-fluoro-2-propylnaphthalene |
|---|---|
| PubChem CID | 139860541 |
| Molecular Formula | C23H27F3O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 6-[difluoro-[4-[(E)-prop-1-enyl]cyclohexyl]methoxy]-3-fluoro-2-propylnaphthalene |
| SMILES | C/C=C/C1CCC(C(F)(F)Oc2ccc3cc(CCC)c(F)cc3c2)CC1 |
| InChI | InChI=1S/C23H27F3O/c1-3-5-16-7-10-20(11-8-16)23(25,26)27-21-12-9-17-13-18(6-4-2)22(24)15-19(17)14-21/h3,5,9,12-16,20H,4,6-8,10-11H2,1-2H3/b5-3+ |
| InChIKey | WUSJCFFKBJRTDL-HWKANZROSA-N |
| XLogP | 7.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|