C24H27F3O — CID 139862155
2-[(4-but-3-enylcyclohexyl)-difluoromethoxy]-3-fluoro-6-[(E)-prop-1-enyl]naphthalene (PubChem CID 139862155) has the molecular formula C24H27F3O and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-[(4-but-3-enylcyclohexyl)-difluoromethoxy]-3-fluoro-6-[(E)-prop-1-enyl]naphthalene.
| Compound Name | 2-[(4-but-3-enylcyclohexyl)-difluoromethoxy]-3-fluoro-6-[(E)-prop-1-enyl]naphthalene |
|---|---|
| PubChem CID | 139862155 |
| Molecular Formula | C24H27F3O |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 2-[(4-but-3-enylcyclohexyl)-difluoromethoxy]-3-fluoro-6-[(E)-prop-1-enyl]naphthalene |
| SMILES | C=CCCC1CCC(C(F)(F)Oc2cc3ccc(/C=C/C)cc3cc2F)CC1 |
| InChI | InChI=1S/C24H27F3O/c1-3-5-7-17-9-12-21(13-10-17)24(26,27)28-23-16-19-11-8-18(6-4-2)14-20(19)15-22(23)25/h3-4,6,8,11,14-17,21H,1,5,7,9-10,12-13H2,2H3/b6-4+ |
| InChIKey | DIEDRTLJUIRIDF-GQCTYLIASA-N |
| XLogP | 7.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|