C27H23F5O3 — CID 88998397
5-[[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-2-ethenyloxane (PubChem CID 88998397) has the molecular formula C27H23F5O3 and a molecular weight of 490.47 g/mol. Its IUPAC name is 5-[[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-2-ethenyloxane.
| Compound Name | 5-[[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-2-ethenyloxane |
|---|---|
| PubChem CID | 88998397 |
| Molecular Formula | C27H23F5O3 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 5-[[4-[4-(2,3-difluoro-4-methoxyphenyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-2-ethenyloxane |
| SMILES | C=CC1CCC(C(F)(F)Oc2ccc(-c3ccc(-c4ccc(OC)c(F)c4F)cc3)c(F)c2)CO1 |
| InChI | InChI=1S/C27H23F5O3/c1-3-19-9-8-18(15-34-19)27(31,32)35-20-10-11-21(23(28)14-20)16-4-6-17(7-5-16)22-12-13-24(33-2)26(30)25(22)29/h3-7,10-14,18-19H,1,8-9,15H2,2H3 |
| InChIKey | BKCKVQSAZBUETM-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|