C20H27F — CID 58718952
5-fluoro-2-heptyl-6-prop-1-ynyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 58718952) has the molecular formula C20H27F and a molecular weight of 286.43 g/mol. Its IUPAC name is 5-fluoro-2-heptyl-6-prop-1-ynyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-fluoro-2-heptyl-6-prop-1-ynyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 58718952 |
| Molecular Formula | C20H27F |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 5-fluoro-2-heptyl-6-prop-1-ynyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC#Cc1ccc2c(c1F)CCC(CCCCCCC)C2 |
| InChI | InChI=1S/C20H27F/c1-3-5-6-7-8-10-16-11-14-19-18(15-16)13-12-17(9-4-2)20(19)21/h12-13,16H,3,5-8,10-11,14-15H2,1-2H3 |
| InChIKey | TTZVYCUKKFTNCH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|