C29H29F5O — CID 139868741
2-but-3-enyl-6-[4-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-3-fluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139868741) has the molecular formula C29H29F5O and a molecular weight of 488.54 g/mol. Its IUPAC name is 2-but-3-enyl-6-[4-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-3-fluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-but-3-enyl-6-[4-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-3-fluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139868741 |
| Molecular Formula | C29H29F5O |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-but-3-enyl-6-[4-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-3-fluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCCC1CCC2CC(c3ccc(C#Cc4cc(F)c(OC(F)F)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C29H29F5O/c1-2-3-4-18-5-8-22-16-23(12-11-21(22)13-18)24-10-9-20(25(30)17-24)7-6-19-14-26(31)28(27(32)15-19)35-29(33)34/h2,9-10,14-15,17-18,21-23,29H,1,3-5,8,11-13,16H2 |
| InChIKey | FGNHAKSMCPYWRW-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|