C26H26ClNS — CID 171419568
1-chloro-5-[2-[4-[4-(cyclopropylmethyl)cyclohexyl]phenyl]ethynyl]-2-isothiocyanato-3-methylbenzene (PubChem CID 171419568) has the molecular formula C26H26ClNS and a molecular weight of 420.02 g/mol. Its IUPAC name is 1-chloro-5-[2-[4-[4-(cyclopropylmethyl)cyclohexyl]phenyl]ethynyl]-2-isothiocyanato-3-methylbenzene.
| Compound Name | 1-chloro-5-[2-[4-[4-(cyclopropylmethyl)cyclohexyl]phenyl]ethynyl]-2-isothiocyanato-3-methylbenzene |
|---|---|
| PubChem CID | 171419568 |
| Molecular Formula | C26H26ClNS |
| Molecular Weight | 420.02 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-chloro-5-[2-[4-[4-(cyclopropylmethyl)cyclohexyl]phenyl]ethynyl]-2-isothiocyanato-3-methylbenzene |
| SMILES | Cc1cc(C#Cc2ccc(C3CCC(CC4CC4)CC3)cc2)cc(Cl)c1N=C=S |
| InChI | InChI=1S/C26H26ClNS/c1-18-14-22(16-25(27)26(18)28-17-29)5-2-19-6-10-23(11-7-19)24-12-8-21(9-13-24)15-20-3-4-20/h6-7,10-11,14,16,20-21,24H,3-4,8-9,12-13,15H2,1H3 |
| InChIKey | GMXZPLDDKSLUFB-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.02 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|