C27H26FNS — CID 155300761
1-fluoro-2-isothiocyanato-3-prop-1-en-2-yl-5-[2-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]ethynyl]benzene (PubChem CID 155300761) has the molecular formula C27H26FNS and a molecular weight of 415.58 g/mol. Its IUPAC name is 1-fluoro-2-isothiocyanato-3-prop-1-en-2-yl-5-[2-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]ethynyl]benzene.
| Compound Name | 1-fluoro-2-isothiocyanato-3-prop-1-en-2-yl-5-[2-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 155300761 |
| Molecular Formula | C27H26FNS |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 1-fluoro-2-isothiocyanato-3-prop-1-en-2-yl-5-[2-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]ethynyl]benzene |
| SMILES | C=C(C)c1cc(C#Cc2ccc(C3CCC(/C=C/C)CC3)cc2)cc(F)c1N=C=S |
| InChI | InChI=1S/C27H26FNS/c1-4-5-20-8-12-23(13-9-20)24-14-10-21(11-15-24)6-7-22-16-25(19(2)3)27(29-18-30)26(28)17-22/h4-5,10-11,14-17,20,23H,2,8-9,12-13H2,1,3H3/b5-4+ |
| InChIKey | AXAMPFXBBRTMFM-SNAWJCMRSA-N |
| XLogP | 7.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|