C24H14F3NS — CID 171752426
1,3-difluoro-5-[4-[2-[2-fluoro-4-[(E)-prop-1-enyl]phenyl]ethynyl]phenyl]-2-isothiocyanatobenzene (PubChem CID 171752426) has the molecular formula C24H14F3NS and a molecular weight of 405.44 g/mol. Its IUPAC name is 1,3-difluoro-5-[4-[2-[2-fluoro-4-[(E)-prop-1-enyl]phenyl]ethynyl]phenyl]-2-isothiocyanatobenzene.
| Compound Name | 1,3-difluoro-5-[4-[2-[2-fluoro-4-[(E)-prop-1-enyl]phenyl]ethynyl]phenyl]-2-isothiocyanatobenzene |
|---|---|
| PubChem CID | 171752426 |
| Molecular Formula | C24H14F3NS |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 1,3-difluoro-5-[4-[2-[2-fluoro-4-[(E)-prop-1-enyl]phenyl]ethynyl]phenyl]-2-isothiocyanatobenzene |
| SMILES | C/C=C/c1ccc(C#Cc2ccc(-c3cc(F)c(N=C=S)c(F)c3)cc2)c(F)c1 |
| InChI | InChI=1S/C24H14F3NS/c1-2-3-17-7-11-19(21(25)12-17)10-6-16-4-8-18(9-5-16)20-13-22(26)24(28-15-29)23(27)14-20/h2-5,7-9,11-14H,1H3/b3-2+ |
| InChIKey | OTCBUWOTDFVYPO-NSCUHMNNSA-N |
| XLogP | 6.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|