C16H8F2N2S — CID 73448226
4-[2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]benzonitrile (PubChem CID 73448226) has the molecular formula C16H8F2N2S and a molecular weight of 298.32 g/mol. Its IUPAC name is 4-[2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]benzonitrile.
| Compound Name | 4-[2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]benzonitrile |
|---|---|
| PubChem CID | 73448226 |
| Molecular Formula | C16H8F2N2S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 4-[2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]benzonitrile |
| SMILES | N#Cc1ccc(C=Cc2cc(F)c(N=C=S)c(F)c2)cc1 |
| InChI | InChI=1S/C16H8F2N2S/c17-14-7-13(8-15(18)16(14)20-10-21)6-3-11-1-4-12(9-19)5-2-11/h1-8H |
| InChIKey | YVCCLWYEQFVBHI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|