C33H27NO2 — CID 10895981
4-[(E)-2-[3,5-bis[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]ethenyl]benzonitrile (PubChem CID 10895981) has the molecular formula C33H27NO2 and a molecular weight of 469.58 g/mol. Its IUPAC name is 4-[(E)-2-[3,5-bis[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]ethenyl]benzonitrile.
| Compound Name | 4-[(E)-2-[3,5-bis[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 10895981 |
| Molecular Formula | C33H27NO2 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 4-[(E)-2-[3,5-bis[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]ethenyl]benzonitrile |
| SMILES | COc1ccc(/C=C/c2cc(/C=C/c3ccc(C#N)cc3)cc(/C=C/c3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C33H27NO2/c1-35-32-17-13-26(14-18-32)6-11-30-21-29(10-5-25-3-8-28(24-34)9-4-25)22-31(23-30)12-7-27-15-19-33(36-2)20-16-27/h3-23H,1-2H3/b10-5+,11-6+,12-7+ |
| InChIKey | WOZZGBZTFPUVRQ-HCFQACMASA-N |
| XLogP | 8.09 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|