C19H19NO4 — CID 57430908
4-[(E)-2-[3,5-bis(methoxymethoxy)phenyl]ethenyl]benzonitrile (PubChem CID 57430908) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 4-[(E)-2-[3,5-bis(methoxymethoxy)phenyl]ethenyl]benzonitrile.
| Compound Name | 4-[(E)-2-[3,5-bis(methoxymethoxy)phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 57430908 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 4-[(E)-2-[3,5-bis(methoxymethoxy)phenyl]ethenyl]benzonitrile |
| SMILES | COCOc1cc(/C=C/c2ccc(C#N)cc2)cc(OCOC)c1 |
| InChI | InChI=1S/C19H19NO4/c1-21-13-23-18-9-17(10-19(11-18)24-14-22-2)8-5-15-3-6-16(12-20)7-4-15/h3-11H,13-14H2,1-2H3/b8-5+ |
| InChIKey | ACQBJUYMYOPHPL-VMPITWQZSA-N |
| XLogP | 3.69 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|