C52H46N2O6 — CID 139175976
4-[(E)-2-[4-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]phenyl]ethenyl]benzonitrile (PubChem CID 139175976) has the molecular formula C52H46N2O6 and a molecular weight of 794.95 g/mol. Its IUPAC name is 4-[(E)-2-[4-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]phenyl]ethenyl]benzonitrile.
| Compound Name | 4-[(E)-2-[4-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 139175976 |
| Molecular Formula | C52H46N2O6 |
| Molecular Weight | 794.95 g/mol |
| Exact Mass | 794.34 |
| IUPAC Name | 4-[(E)-2-[4-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]phenyl]ethenyl]benzonitrile |
| SMILES | COc1cc(OC)c(/C=C/c2ccc(/C=C/c3ccc(C#N)cc3)cc2)c(OC)c1.COc1cc(OC)c(/C=C/c2ccc(/C=C/c3ccc(C#N)cc3)cc2)c(OC)c1 |
| InChI | InChI=1S/2C26H23NO3/c2*1-28-23-16-25(29-2)24(26(17-23)30-3)15-14-21-8-6-19(7-9-21)4-5-20-10-12-22(18-27)13-11-20/h2*4-17H,1-3H3/b2*5-4+,15-14+ |
| InChIKey | FZNWZQOMFRBFDS-CAANZARZSA-N |
| XLogP | 11.85 |
| TPSA | 102.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.95 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|