C10H6F3N — CID 10987201
4-[(E)-3,3,3-trifluoroprop-1-enyl]benzonitrile (PubChem CID 10987201) has the molecular formula C10H6F3N and a molecular weight of 197.16 g/mol. Its IUPAC name is 4-[(E)-3,3,3-trifluoroprop-1-enyl]benzonitrile.
| Compound Name | 4-[(E)-3,3,3-trifluoroprop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 10987201 |
| Molecular Formula | C10H6F3N |
| Molecular Weight | 197.16 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 4-[(E)-3,3,3-trifluoroprop-1-enyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C/C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H6F3N/c11-10(12,13)6-5-8-1-3-9(7-14)4-2-8/h1-6H/b6-5+ |
| InChIKey | NKVOAOJSIODWRV-AATRIKPKSA-N |
| XLogP | 3.13 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.16 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |