C16H14F2N2S — CID 163447094
4-[(E)-2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]cyclohexane-1-carbonitrile (PubChem CID 163447094) has the molecular formula C16H14F2N2S and a molecular weight of 304.37 g/mol. Its IUPAC name is 4-[(E)-2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[(E)-2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 163447094 |
| Molecular Formula | C16H14F2N2S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-[(E)-2-(3,5-difluoro-4-isothiocyanatophenyl)ethenyl]cyclohexane-1-carbonitrile |
| SMILES | N#CC1CCC(/C=C/c2cc(F)c(N=C=S)c(F)c2)CC1 |
| InChI | InChI=1S/C16H14F2N2S/c17-14-7-13(8-15(18)16(14)20-10-21)6-3-11-1-4-12(9-19)5-2-11/h3,6-8,11-12H,1-2,4-5H2/b6-3+ |
| InChIKey | BDKZIMPJBZTJHL-ZZXKWVIFSA-N |
| XLogP | 5.04 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|