C25H23F4NO2 — CID 20717214
(4-cyano-3,5-difluorophenyl) 2,6-difluoro-4-[(E)-2-(4-propylcyclohexyl)ethenyl]benzoate (PubChem CID 20717214) has the molecular formula C25H23F4NO2 and a molecular weight of 445.46 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 2,6-difluoro-4-[(E)-2-(4-propylcyclohexyl)ethenyl]benzoate.
| Compound Name | (4-cyano-3,5-difluorophenyl) 2,6-difluoro-4-[(E)-2-(4-propylcyclohexyl)ethenyl]benzoate |
|---|---|
| PubChem CID | 20717214 |
| Molecular Formula | C25H23F4NO2 |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 2,6-difluoro-4-[(E)-2-(4-propylcyclohexyl)ethenyl]benzoate |
| SMILES | CCCC1CCC(/C=C/c2cc(F)c(C(=O)Oc3cc(F)c(C#N)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C25H23F4NO2/c1-2-3-15-4-6-16(7-5-15)8-9-17-10-22(28)24(23(29)11-17)25(31)32-18-12-20(26)19(14-30)21(27)13-18/h8-13,15-16H,2-7H2,1H3/b9-8+ |
| InChIKey | YNEWSKCFIAEOJV-CMDGGOBGSA-N |
| XLogP | 6.95 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|