C20H15F4NO4 — CID 162747215
(4-cyano-3,5-difluorophenyl) 4-(5-ethyl-1,3-dioxan-2-yl)-2,6-difluorobenzoate (PubChem CID 162747215) has the molecular formula C20H15F4NO4 and a molecular weight of 409.34 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 4-(5-ethyl-1,3-dioxan-2-yl)-2,6-difluorobenzoate.
| Compound Name | (4-cyano-3,5-difluorophenyl) 4-(5-ethyl-1,3-dioxan-2-yl)-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 162747215 |
| Molecular Formula | C20H15F4NO4 |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 4-(5-ethyl-1,3-dioxan-2-yl)-2,6-difluorobenzoate |
| SMILES | CCC1COC(c2cc(F)c(C(=O)Oc3cc(F)c(C#N)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C20H15F4NO4/c1-2-10-8-27-20(28-9-10)11-3-16(23)18(17(24)4-11)19(26)29-12-5-14(21)13(7-25)15(22)6-12/h3-6,10,20H,2,8-9H2,1H3 |
| InChIKey | SXXPOKLQPQBGLO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|