C24H29F2NO2 — CID 21032701
(4-cyano-3,5-difluorophenyl) (2R,4aS,10aR)-7-ethyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carboxylate (PubChem CID 21032701) has the molecular formula C24H29F2NO2 and a molecular weight of 401.50 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) (2R,4aS,10aR)-7-ethyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carboxylate.
| Compound Name | (4-cyano-3,5-difluorophenyl) (2R,4aS,10aR)-7-ethyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 21032701 |
| Molecular Formula | C24H29F2NO2 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) (2R,4aS,10aR)-7-ethyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carboxylate |
| SMILES | CCC1CCC2C(CC[C@@H]3C[C@H](C(=O)Oc4cc(F)c(C#N)c(F)c4)CC[C@H]23)C1 |
| InChI | InChI=1S/C24H29F2NO2/c1-2-14-3-7-19-15(9-14)4-5-16-10-17(6-8-20(16)19)24(28)29-18-11-22(25)21(13-27)23(26)12-18/h11-12,14-17,19-20H,2-10H2,1H3/t14?,15?,16-,17-,19?,20+/m1/s1 |
| InChIKey | SBEKTLZZOCNFGY-DHRDAQJESA-N |
| XLogP | 6.01 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|