C18H21ClF2 — CID 142649740
2-[(E)-2-(4-chloro-3,5-difluorophenyl)ethenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 142649740) has the molecular formula C18H21ClF2 and a molecular weight of 310.81 g/mol. Its IUPAC name is 2-[(E)-2-(4-chloro-3,5-difluorophenyl)ethenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[(E)-2-(4-chloro-3,5-difluorophenyl)ethenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 142649740 |
| Molecular Formula | C18H21ClF2 |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-[(E)-2-(4-chloro-3,5-difluorophenyl)ethenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | Fc1cc(/C=C/C2CCC3CCCCC3C2)cc(F)c1Cl |
| InChI | InChI=1S/C18H21ClF2/c19-18-16(20)10-13(11-17(18)21)6-5-12-7-8-14-3-1-2-4-15(14)9-12/h5-6,10-12,14-15H,1-4,7-9H2/b6-5+ |
| InChIKey | ZESBBIDNWBEBOI-AATRIKPKSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|